C19H18O10Zn — CID 159790873
zinc;phthalate;2-prop-2-enoyloxyethyl 3-prop-2-enoyloxypropanoate (PubChem CID 159790873) has the molecular formula C19H18O10Zn and a molecular weight of 471.73 g/mol. Its IUPAC name is zinc;phthalate;2-prop-2-enoyloxyethyl 3-prop-2-enoyloxypropanoate.
| Compound Name | zinc;phthalate;2-prop-2-enoyloxyethyl 3-prop-2-enoyloxypropanoate |
|---|---|
| PubChem CID | 159790873 |
| Molecular Formula | C19H18O10Zn |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 470.02 |
| IUPAC Name | zinc;phthalate;2-prop-2-enoyloxyethyl 3-prop-2-enoyloxypropanoate |
| SMILES | C=CC(=O)OCCOC(=O)CCOC(=O)C=C.O=C([O-])c1ccccc1C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/C11H14O6.C8H6O4.Zn/c1-3-9(12)15-6-5-11(14)17-8-7-16-10(13)4-2;9-7(10)5-3-1-2-4-6(5)8(11)12;/h3-4H,1-2,5-8H2;1-4H,(H,9,10)(H,11,12);/q;;+2/p-2 |
| InChIKey | NINPWJAYQIDUNQ-UHFFFAOYSA-L |
| XLogP | -1.21 |
| TPSA | 159.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|