About 2-dec-9-enoxybenzoate
2-dec-9-enoxybenzoate (PubChem CID 22354189) has the molecular formula C17H23O3-
and a molecular weight of 275.37 g/mol. Its IUPAC name is 2-dec-9-enoxybenzoate.
Molecular Properties
| Compound Name | 2-dec-9-enoxybenzoate |
| PubChem CID | 22354189 |
| Molecular Formula | C17H23O3- |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-dec-9-enoxybenzoate |
| SMILES | C=CCCCCCCCCOc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C17H24O3/c1-2-3-4-5-6-7-8-11-14-20-16-13-10-9-12-15(16)17(18)19/h2,9-10,12-13H,1,3-8,11,14H2,(H,18,19)/p-1 |
| InChIKey | KWBQQKZWZKMVPE-UHFFFAOYSA-M |
| XLogP | 3.35 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-dec-9-enoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dec-9-enoxybenzoate?
The IUPAC name of 2-dec-9-enoxybenzoate (CID 22354189) is 2-dec-9-enoxybenzoate.
What is the SMILES notation for 2-dec-9-enoxybenzoate?
The canonical SMILES for 2-dec-9-enoxybenzoate is C=CCCCCCCCCOc1ccccc1C(=O)[O-].
What is the InChIKey of 2-dec-9-enoxybenzoate?
The InChIKey is KWBQQKZWZKMVPE-UHFFFAOYSA-M. The full InChI is InChI=1S/C17H24O3/c1-2-3-4-5-6-7-8-11-14-20-16-13-10-9-12-15(16)17(18)19/h2,9-10,12-13H,1,3-8,11,14H2,(H,18,19)/p-1.
What are the key properties of 2-dec-9-enoxybenzoate?
2-dec-9-enoxybenzoate has a molecular weight of 275.37 g/mol, XLogP of 3.35, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dec-9-enoxybenzoate is sourced from PubChem (CID 22354189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).