About dec-9-enoxymethylbenzene
dec-9-enoxymethylbenzene (PubChem CID 91868068) has the molecular formula C17H25O-
and a molecular weight of 245.39 g/mol. Its IUPAC name is dec-9-enoxymethylbenzene.
Molecular Properties
| Compound Name | dec-9-enoxymethylbenzene |
| PubChem CID | 91868068 |
| Molecular Formula | C17H25O- |
| Molecular Weight | 245.39 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | dec-9-enoxymethylbenzene |
| SMILES | C=CCCCCCCCCO[CH-]c1ccccc1 |
| InChI | InChI=1S/C17H25O/c1-2-3-4-5-6-7-8-12-15-18-16-17-13-10-9-11-14-17/h2,9-11,13-14,16H,1,3-8,12,15H2/q-1 |
| InChIKey | LDQXPRWYGYNKLK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 245.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dec-9-enoxymethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dec-9-enoxymethylbenzene?
The IUPAC name of dec-9-enoxymethylbenzene (CID 91868068) is dec-9-enoxymethylbenzene.
What is the SMILES notation for dec-9-enoxymethylbenzene?
The canonical SMILES for dec-9-enoxymethylbenzene is C=CCCCCCCCCO[CH-]c1ccccc1.
What is the InChIKey of dec-9-enoxymethylbenzene?
The InChIKey is LDQXPRWYGYNKLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25O/c1-2-3-4-5-6-7-8-12-15-18-16-17-13-10-9-11-14-17/h2,9-11,13-14,16H,1,3-8,12,15H2/q-1.
What are the key properties of dec-9-enoxymethylbenzene?
dec-9-enoxymethylbenzene has a molecular weight of 245.39 g/mol, XLogP of 5.13, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dec-9-enoxymethylbenzene is sourced from PubChem (CID 91868068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).