About magnesium bis(2-decoxybenzoate)
magnesium bis(2-decoxybenzoate) (PubChem CID 70413847) has the molecular formula C34H50MgO6
and a molecular weight of 579.07 g/mol. Its IUPAC name is magnesium bis(2-decoxybenzoate).
Molecular Properties
| Compound Name | magnesium bis(2-decoxybenzoate) |
| PubChem CID | 70413847 |
| Molecular Formula | C34H50MgO6 |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.35 |
| IUPAC Name | magnesium bis(2-decoxybenzoate) |
| SMILES | CCCCCCCCCCOc1ccccc1C(=O)[O-].CCCCCCCCCCOc1ccccc1C(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C17H26O3.Mg/c2*1-2-3-4-5-6-7-8-11-14-20-16-13-10-9-12-15(16)17(18)19;/h2*9-10,12-13H,2-8,11,14H2,1H3,(H,18,19);/q;;+2/p-2 |
| InChIKey | HRVFWFDIGHRSFG-UHFFFAOYSA-L |
| XLogP | 6.76 |
| TPSA | 98.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze magnesium bis(2-decoxybenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(2-decoxybenzoate)?
The IUPAC name of magnesium bis(2-decoxybenzoate) (CID 70413847) is magnesium bis(2-decoxybenzoate).
What is the SMILES notation for magnesium bis(2-decoxybenzoate)?
The canonical SMILES for magnesium bis(2-decoxybenzoate) is CCCCCCCCCCOc1ccccc1C(=O)[O-].CCCCCCCCCCOc1ccccc1C(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(2-decoxybenzoate)?
The InChIKey is HRVFWFDIGHRSFG-UHFFFAOYSA-L. The full InChI is InChI=1S/2C17H26O3.Mg/c2*1-2-3-4-5-6-7-8-11-14-20-16-13-10-9-12-15(16)17(18)19;/h2*9-10,12-13H,2-8,11,14H2,1H3,(H,18,19);/q;;+2/p-2.
What are the key properties of magnesium bis(2-decoxybenzoate)?
magnesium bis(2-decoxybenzoate) has a molecular weight of 579.07 g/mol, XLogP of 6.76, 22 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(2-decoxybenzoate) is sourced from PubChem (CID 70413847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).