C32H44N2O7 — CID 71257105
2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxyacetyl)amino]ethoxycarbonylamino]benzoic acid (PubChem CID 71257105) has the molecular formula C32H44N2O7 and a molecular weight of 568.71 g/mol. Its IUPAC name is 2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxyacetyl)amino]ethoxycarbonylamino]benzoic acid.
| Compound Name | 2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxyacetyl)amino]ethoxycarbonylamino]benzoic acid |
|---|---|
| PubChem CID | 71257105 |
| Molecular Formula | C32H44N2O7 |
| Molecular Weight | 568.71 g/mol |
| Exact Mass | 568.31 |
| IUPAC Name | 2-hydroxy-5-[2-[(2-icosa-5,8,11,14,17-pentaenoxyacetyl)amino]ethoxycarbonylamino]benzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCOCC(=O)NCCOC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C32H44N2O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-40-26-30(36)33-22-24-41-32(39)34-27-20-21-29(35)28(25-27)31(37)38/h3-4,6-7,9-10,12-13,15-16,20-21,25,35H,2,5,8,11,14,17-19,22-24,26H2,1H3,(H,33,36)(H,34,39)(H,37,38) |
| InChIKey | VQONEVZZMTUGQO-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.71 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|