C37H53NO6S — CID 160803188
5-[[5-ethyl-5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-4-oxoheptoxy]carbonylamino]-2-hydroxybenzoic acid (PubChem CID 160803188) has the molecular formula C37H53NO6S and a molecular weight of 639.90 g/mol. Its IUPAC name is 5-[[5-ethyl-5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-4-oxoheptoxy]carbonylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[[5-ethyl-5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-4-oxoheptoxy]carbonylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 160803188 |
| Molecular Formula | C37H53NO6S |
| Molecular Weight | 639.90 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | 5-[[5-ethyl-5-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenyl]sulfanyl-4-oxoheptoxy]carbonylamino]-2-hydroxybenzoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCSC(CC)(CC)C(=O)CCCOC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C37H53NO6S/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-29-45-37(5-2,6-3)34(40)25-24-28-44-36(43)38-31-26-27-33(39)32(30-31)35(41)42/h7-8,10-11,13-14,16-17,19-20,26-27,30,39H,4-6,9,12,15,18,21-25,28-29H2,1-3H3,(H,38,43)(H,41,42)/b8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | SDIVFZDUWBQMLX-NEUKSRIFSA-N |
| XLogP | 10.20 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.90 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|