C36H51N3O6 — CID 53339672
5-[2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]butanoylamino]ethylcarbamoylamino]-2-hydroxybenzoic acid (PubChem CID 53339672) has the molecular formula C36H51N3O6 and a molecular weight of 621.82 g/mol. Its IUPAC name is 5-[2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]butanoylamino]ethylcarbamoylamino]-2-hydroxybenzoic acid.
| Compound Name | 5-[2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]butanoylamino]ethylcarbamoylamino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 53339672 |
| Molecular Formula | C36H51N3O6 |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | 5-[2-[2-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoxy]butanoylamino]ethylcarbamoylamino]-2-hydroxybenzoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCOC(CC)C(=O)NCCNC(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C36H51N3O6/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-28-45-33(4-2)34(41)37-26-27-38-36(44)39-30-24-25-32(40)31(29-30)35(42)43/h5-6,8-9,11-12,14-15,17-18,20-21,24-25,29,33,40H,3-4,7,10,13,16,19,22-23,26-28H2,1-2H3,(H,37,41)(H,42,43)(H2,38,39,44)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | TYSRLDPLSKEEGT-YNUSHXQLSA-N |
| XLogP | 7.60 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|