C35H50N2O6 — CID 71256885
2-hydroxy-5-[[4-methyl-2-(2-octadeca-3,6,9,12,15-pentaenoxybutanoylamino)pentanoyl]amino]benzoic acid (PubChem CID 71256885) has the molecular formula C35H50N2O6 and a molecular weight of 594.79 g/mol. Its IUPAC name is 2-hydroxy-5-[[4-methyl-2-(2-octadeca-3,6,9,12,15-pentaenoxybutanoylamino)pentanoyl]amino]benzoic acid.
| Compound Name | 2-hydroxy-5-[[4-methyl-2-(2-octadeca-3,6,9,12,15-pentaenoxybutanoylamino)pentanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 71256885 |
| Molecular Formula | C35H50N2O6 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.37 |
| IUPAC Name | 2-hydroxy-5-[[4-methyl-2-(2-octadeca-3,6,9,12,15-pentaenoxybutanoylamino)pentanoyl]amino]benzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCOC(CC)C(=O)NC(CC(C)C)C(=O)Nc1ccc(O)c(C(=O)O)c1 |
| InChI | InChI=1S/C35H50N2O6/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-43-32(6-2)34(40)37-30(25-27(3)4)33(39)36-28-22-23-31(38)29(26-28)35(41)42/h7-8,10-11,13-14,16-17,19-20,22-23,26-27,30,32,38H,5-6,9,12,15,18,21,24-25H2,1-4H3,(H,36,39)(H,37,40)(H,41,42) |
| InChIKey | LHWSGWZAQVHGDZ-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|