C36H50O6 — CID 161185465
2-[2-(2-methylpropyl)-5-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]-4-oxoheptanoyl]oxybenzoic acid (PubChem CID 161185465) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is 2-[2-(2-methylpropyl)-5-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]-4-oxoheptanoyl]oxybenzoic acid.
| Compound Name | 2-[2-(2-methylpropyl)-5-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]-4-oxoheptanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 161185465 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 2-[2-(2-methylpropyl)-5-[(3Z,6Z,9Z,12Z,15Z)-octadeca-3,6,9,12,15-pentaenoxy]-4-oxoheptanoyl]oxybenzoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCOC(CC)C(=O)CC(CC(C)C)C(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C36H50O6/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-26-41-33(6-2)32(37)28-30(27-29(3)4)36(40)42-34-25-22-21-24-31(34)35(38)39/h7-8,10-11,13-14,16-17,19-22,24-25,29-30,33H,5-6,9,12,15,18,23,26-28H2,1-4H3,(H,38,39)/b8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | UTAIMATZZBPBNA-NEUKSRIFSA-N |
| XLogP | 8.85 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|