C36H51NO6S — CID 77473759
2-[2-[(2-icosa-5,8,11,14,17-pentaenylsulfanyl-2-methoxyacetyl)amino]-4-methylpentanoyl]oxybenzoic acid (PubChem CID 77473759) has the molecular formula C36H51NO6S and a molecular weight of 625.87 g/mol. Its IUPAC name is 2-[2-[(2-icosa-5,8,11,14,17-pentaenylsulfanyl-2-methoxyacetyl)amino]-4-methylpentanoyl]oxybenzoic acid.
| Compound Name | 2-[2-[(2-icosa-5,8,11,14,17-pentaenylsulfanyl-2-methoxyacetyl)amino]-4-methylpentanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 77473759 |
| Molecular Formula | C36H51NO6S |
| Molecular Weight | 625.87 g/mol |
| Exact Mass | 625.34 |
| IUPAC Name | 2-[2-[(2-icosa-5,8,11,14,17-pentaenylsulfanyl-2-methoxyacetyl)amino]-4-methylpentanoyl]oxybenzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCCSC(OC)C(=O)NC(CC(C)C)C(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C36H51NO6S/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-27-44-36(42-4)33(38)37-31(28-29(2)3)35(41)43-32-26-23-22-25-30(32)34(39)40/h6-7,9-10,12-13,15-16,18-19,22-23,25-26,29,31,36H,5,8,11,14,17,20-21,24,27-28H2,1-4H3,(H,37,38)(H,39,40) |
| InChIKey | ZOGVMEHFWPACGA-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.87 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|