C28H34O4 — CID 123878654
2-henicosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid (PubChem CID 123878654) has the molecular formula C28H34O4 and a molecular weight of 434.58 g/mol. Its IUPAC name is 2-henicosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid.
| Compound Name | 2-henicosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid |
|---|---|
| PubChem CID | 123878654 |
| Molecular Formula | C28H34O4 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | 2-henicosa-4,7,10,13,16,19-hexaenoyloxybenzoic acid |
| SMILES | CC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C28H34O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24-27(29)32-26-23-21-20-22-25(26)28(30)31/h2-3,5-6,8-9,11-12,14-15,17-18,20-23H,4,7,10,13,16,19,24H2,1H3,(H,30,31) |
| InChIKey | PYKFDFAMZALOAM-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|