C26H34O5 — CID 77473510
2-(2-pentadeca-3,6,9,12-tetraenoxybutanoyloxy)benzoic acid (PubChem CID 77473510) has the molecular formula C26H34O5 and a molecular weight of 426.55 g/mol. Its IUPAC name is 2-(2-pentadeca-3,6,9,12-tetraenoxybutanoyloxy)benzoic acid.
| Compound Name | 2-(2-pentadeca-3,6,9,12-tetraenoxybutanoyloxy)benzoic acid |
|---|---|
| PubChem CID | 77473510 |
| Molecular Formula | C26H34O5 |
| Molecular Weight | 426.55 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | 2-(2-pentadeca-3,6,9,12-tetraenoxybutanoyloxy)benzoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCCOC(CC)C(=O)Oc1ccccc1C(=O)O |
| InChI | InChI=1S/C26H34O5/c1-3-5-6-7-8-9-10-11-12-13-14-15-18-21-30-23(4-2)26(29)31-24-20-17-16-19-22(24)25(27)28/h5-6,8-9,11-12,14-17,19-20,23H,3-4,7,10,13,18,21H2,1-2H3,(H,27,28) |
| InChIKey | SPPPBQJSNSSUKZ-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.55 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|