2-hexa-2,4-dienoxybenzoic acid

C13H14O3 — CID 91084675

IUPAC2-hexa-2,4-dienoxybenzoic acid
SMILESCC=CC=CCOc1ccccc1C(=O)O
InChIInChI=1S/C13H14O3/c1-2-3-4-7-10-16-12-9-6-5-8-11(12)13(14)15/h2-9H,10H2,1H3,(H,14,15)
InChIKeyOJSJBYMLYYZFOF-UHFFFAOYSA-N
MW218.25 g/mol
LogP2.90
Rot. Bonds5

About 2-hexa-2,4-dienoxybenzoic acid

2-hexa-2,4-dienoxybenzoic acid (PubChem CID 91084675) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-hexa-2,4-dienoxybenzoic acid.

Molecular Properties

Compound Name2-hexa-2,4-dienoxybenzoic acid
PubChem CID91084675
Molecular FormulaC13H14O3
Molecular Weight218.25 g/mol
Exact Mass218.09
IUPAC Name2-hexa-2,4-dienoxybenzoic acid
SMILESCC=CC=CCOc1ccccc1C(=O)O
InChIInChI=1S/C13H14O3/c1-2-3-4-7-10-16-12-9-6-5-8-11(12)13(14)15/h2-9H,10H2,1H3,(H,14,15)
InChIKeyOJSJBYMLYYZFOF-UHFFFAOYSA-N
XLogP2.90
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.25
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 2-hexa-2,4-dienoxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hexa-2,4-dienoxybenzoic acid?
The IUPAC name of 2-hexa-2,4-dienoxybenzoic acid (CID 91084675) is 2-hexa-2,4-dienoxybenzoic acid.
What is the SMILES notation for 2-hexa-2,4-dienoxybenzoic acid?
The canonical SMILES for 2-hexa-2,4-dienoxybenzoic acid is CC=CC=CCOc1ccccc1C(=O)O.
What is the InChIKey of 2-hexa-2,4-dienoxybenzoic acid?
The InChIKey is OJSJBYMLYYZFOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O3/c1-2-3-4-7-10-16-12-9-6-5-8-11(12)13(14)15/h2-9H,10H2,1H3,(H,14,15).
What are the key properties of 2-hexa-2,4-dienoxybenzoic acid?
2-hexa-2,4-dienoxybenzoic acid has a molecular weight of 218.25 g/mol, XLogP of 2.90, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexa-2,4-dienoxybenzoic acid is sourced from PubChem (CID 91084675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).