C13H14O3 — CID 87203148
2-[(2E,4E)-hexa-2,4-dienoxy]benzoic acid (PubChem CID 87203148) has the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. Its IUPAC name is 2-[(2E,4E)-hexa-2,4-dienoxy]benzoic acid.
| Compound Name | 2-[(2E,4E)-hexa-2,4-dienoxy]benzoic acid |
|---|---|
| PubChem CID | 87203148 |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-[(2E,4E)-hexa-2,4-dienoxy]benzoic acid |
| SMILES | C/C=C/C=C/COc1ccccc1C(=O)O |
| InChI | InChI=1S/C13H14O3/c1-2-3-4-7-10-16-12-9-6-5-8-11(12)13(14)15/h2-9H,10H2,1H3,(H,14,15)/b3-2+,7-4+ |
| InChIKey | OJSJBYMLYYZFOF-AOGGBPEJSA-N |
| XLogP | 2.90 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|