C44H54F2O5 — CID 153224398
ethyl 5-(2,4-difluorophenyl)-2-[(7Z,10Z,13Z,16Z,19Z,22Z)-2-(2-methylpropyl)-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]oxybenzoate (PubChem CID 153224398) has the molecular formula C44H54F2O5 and a molecular weight of 700.91 g/mol. Its IUPAC name is ethyl 5-(2,4-difluorophenyl)-2-[(7Z,10Z,13Z,16Z,19Z,22Z)-2-(2-methylpropyl)-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]oxybenzoate.
| Compound Name | ethyl 5-(2,4-difluorophenyl)-2-[(7Z,10Z,13Z,16Z,19Z,22Z)-2-(2-methylpropyl)-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]oxybenzoate |
|---|---|
| PubChem CID | 153224398 |
| Molecular Formula | C44H54F2O5 |
| Molecular Weight | 700.91 g/mol |
| Exact Mass | 700.39 |
| IUPAC Name | ethyl 5-(2,4-difluorophenyl)-2-[(7Z,10Z,13Z,16Z,19Z,22Z)-2-(2-methylpropyl)-4-oxopentacosa-7,10,13,16,19,22-hexaenoyl]oxybenzoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)CC(CC(C)C)C(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)OCC |
| InChI | InChI=1S/C44H54F2O5/c1-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-38(47)31-36(30-34(3)4)43(48)51-42-29-26-35(32-40(42)44(49)50-6-2)39-28-27-37(45)33-41(39)46/h7-8,10-11,13-14,16-17,19-20,22-23,26-29,32-34,36H,5-6,9,12,15,18,21,24-25,30-31H2,1-4H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | WOHKBOKKDPNGFU-XTJKPUCJSA-N |
| XLogP | 11.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.91 |
| LogP ≤ 5 | 11.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|