C17H14F2O3S — CID 123921466
[4-(2,4-difluorophenyl)-2-ethylsulfanylcarbonylphenyl] acetate (PubChem CID 123921466) has the molecular formula C17H14F2O3S and a molecular weight of 336.36 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-ethylsulfanylcarbonylphenyl] acetate.
| Compound Name | [4-(2,4-difluorophenyl)-2-ethylsulfanylcarbonylphenyl] acetate |
|---|---|
| PubChem CID | 123921466 |
| Molecular Formula | C17H14F2O3S |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-ethylsulfanylcarbonylphenyl] acetate |
| SMILES | CCSC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(C)=O |
| InChI | InChI=1S/C17H14F2O3S/c1-3-23-17(21)14-8-11(4-7-16(14)22-10(2)20)13-6-5-12(18)9-15(13)19/h4-9H,3H2,1-2H3 |
| InChIKey | WQAYTUYRGFORDH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|