C39H46F2N2O4 — CID 59193318
[4-(2,4-difluorophenyl)-2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylcarbamoyl]phenyl] acetate (PubChem CID 59193318) has the molecular formula C39H46F2N2O4 and a molecular weight of 644.80 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylcarbamoyl]phenyl] acetate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylcarbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 59193318 |
| Molecular Formula | C39H46F2N2O4 |
| Molecular Weight | 644.80 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]ethylcarbamoyl]phenyl] acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCNC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(C)=O |
| InChI | InChI=1S/C39H46F2N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-38(45)42-27-28-43-39(46)35-29-32(23-26-37(35)47-31(2)44)34-25-24-33(40)30-36(34)41/h4-5,7-8,10-11,13-14,16-17,19-20,23-26,29-30H,3,6,9,12,15,18,21-22,27-28H2,1-2H3,(H,42,45)(H,43,46)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | LNPYQEHKULPEDO-JDPCYWKWSA-N |
| XLogP | 8.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.80 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|