C34H43F3N2O4 — CID 72539696
[2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylcarbamoyl]-5-(trifluoromethyl)phenyl] acetate (PubChem CID 72539696) has the molecular formula C34H43F3N2O4 and a molecular weight of 600.72 g/mol. Its IUPAC name is [2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylcarbamoyl]-5-(trifluoromethyl)phenyl] acetate.
| Compound Name | [2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylcarbamoyl]-5-(trifluoromethyl)phenyl] acetate |
|---|---|
| PubChem CID | 72539696 |
| Molecular Formula | C34H43F3N2O4 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.32 |
| IUPAC Name | [2-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)ethylcarbamoyl]-5-(trifluoromethyl)phenyl] acetate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCNC(=O)c1ccc(C(F)(F)F)cc1OC(C)=O |
| InChI | InChI=1S/C34H43F3N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-32(41)38-25-26-39-33(42)30-24-23-29(34(35,36)37)27-31(30)43-28(2)40/h4-5,7-8,10-11,13-14,16-17,19-20,23-24,27H,3,6,9,12,15,18,21-22,25-26H2,1-2H3,(H,38,41)(H,39,42) |
| InChIKey | WBDKVAUFTHDBKH-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|