C37H47F3N2O6 — CID 72539676
5-[[2-acetyloxy-4-(trifluoromethyl)benzoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)pentanoic acid (PubChem CID 72539676) has the molecular formula C37H47F3N2O6 and a molecular weight of 672.79 g/mol. Its IUPAC name is 5-[[2-acetyloxy-4-(trifluoromethyl)benzoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)pentanoic acid.
| Compound Name | 5-[[2-acetyloxy-4-(trifluoromethyl)benzoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)pentanoic acid |
|---|---|
| PubChem CID | 72539676 |
| Molecular Formula | C37H47F3N2O6 |
| Molecular Weight | 672.79 g/mol |
| Exact Mass | 672.34 |
| IUPAC Name | 5-[[2-acetyloxy-4-(trifluoromethyl)benzoyl]amino]-2-(docosa-4,7,10,13,16,19-hexaenoylamino)pentanoic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(CCCNC(=O)c1ccc(C(F)(F)F)cc1OC(C)=O)C(=O)O |
| InChI | InChI=1S/C37H47F3N2O6/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-34(44)42-32(36(46)47)23-22-27-41-35(45)31-26-25-30(37(38,39)40)28-33(31)48-29(2)43/h4-5,7-8,10-11,13-14,16-17,19-20,25-26,28,32H,3,6,9,12,15,18,21-24,27H2,1-2H3,(H,41,45)(H,42,44)(H,46,47) |
| InChIKey | YCNVSPRKSVYQES-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.79 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|