C38H49F3N2O5 — CID 70930510
5-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[2-(2-oxopropyl)-4-(trifluoromethyl)benzoyl]amino]pentanoic acid (PubChem CID 70930510) has the molecular formula C38H49F3N2O5 and a molecular weight of 670.81 g/mol. Its IUPAC name is 5-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[2-(2-oxopropyl)-4-(trifluoromethyl)benzoyl]amino]pentanoic acid.
| Compound Name | 5-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[2-(2-oxopropyl)-4-(trifluoromethyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 70930510 |
| Molecular Formula | C38H49F3N2O5 |
| Molecular Weight | 670.81 g/mol |
| Exact Mass | 670.36 |
| IUPAC Name | 5-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[[2-(2-oxopropyl)-4-(trifluoromethyl)benzoyl]amino]pentanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCC(NC(=O)c1ccc(C(F)(F)F)cc1CC(C)=O)C(=O)O |
| InChI | InChI=1S/C38H49F3N2O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-35(45)42-27-22-23-34(37(47)48)43-36(46)33-26-25-32(38(39,40)41)29-31(33)28-30(2)44/h4-5,7-8,10-11,13-14,16-17,19-20,25-26,29,34H,3,6,9,12,15,18,21-24,27-28H2,1-2H3,(H,42,45)(H,43,46)(H,47,48)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19- |
| InChIKey | FUGDISAZEAKOPV-JDPCYWKWSA-N |
| XLogP | 8.39 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.81 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|