C41H54N2O6 — CID 67092584
methyl 6-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]hexanoate (PubChem CID 67092584) has the molecular formula C41H54N2O6 and a molecular weight of 670.89 g/mol. Its IUPAC name is methyl 6-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]hexanoate.
| Compound Name | methyl 6-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 67092584 |
| Molecular Formula | C41H54N2O6 |
| Molecular Weight | 670.89 g/mol |
| Exact Mass | 670.40 |
| IUPAC Name | methyl 6-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]hexanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NCCCCC(NC(=O)C1=CC(=O)C(C)(c2ccccc2)O1)C(=O)OC |
| InChI | InChI=1S/C41H54N2O6/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-31-38(45)42-32-27-26-30-35(40(47)48-3)43-39(46)36-33-37(44)41(2,49-36)34-28-23-22-24-29-34/h5-6,8-9,11-12,14-15,17-18,20-24,28-29,33,35H,4,7,10,13,16,19,25-27,30-32H2,1-3H3,(H,42,45)(H,43,46) |
| InChIKey | QOEFEVQOOVIGKY-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.89 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|