C25H32N2O8 — CID 58219018
1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]butanoate (PubChem CID 58219018) has the molecular formula C25H32N2O8 and a molecular weight of 488.54 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]butanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 58219018 |
| Molecular Formula | C25H32N2O8 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.22 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[(5-methyl-4-oxo-5-phenylfuran-2-carbonyl)amino]butanoate |
| SMILES | CC/C=C\CC(=O)NCCC(NC(=O)C1=CC(=O)C(C)(c2ccccc2)O1)C(=O)OC(CO)CO |
| InChI | InChI=1S/C25H32N2O8/c1-3-4-6-11-22(31)26-13-12-19(24(33)34-18(15-28)16-29)27-23(32)20-14-21(30)25(2,35-20)17-9-7-5-8-10-17/h4-10,14,18-19,28-29H,3,11-13,15-16H2,1-2H3,(H,26,31)(H,27,32)/b6-4- |
| InChIKey | ZPWQDTQWRYSRDV-XQRVVYSFSA-N |
| XLogP | 0.63 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|