C38H50N2O4 — CID 67092895
N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide (PubChem CID 67092895) has the molecular formula C38H50N2O4 and a molecular weight of 598.83 g/mol. Its IUPAC name is N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide.
| Compound Name | N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 67092895 |
| Molecular Formula | C38H50N2O4 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | N-[2-(docosa-4,7,10,13,16,19-hexaenoylamino)-2-methylpropyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC(C)(C)CNC(=O)C1=CC(=O)C(C)(c2ccccc2)O1 |
| InChI | InChI=1S/C38H50N2O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-26-29-35(42)40-37(2,3)31-39-36(43)33-30-34(41)38(4,44-33)32-27-24-23-25-28-32/h6-7,9-10,12-13,15-16,18-19,21-25,27-28,30H,5,8,11,14,17,20,26,29,31H2,1-4H3,(H,39,43)(H,40,42) |
| InChIKey | VVCYIRNORLTLJQ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|