C36H48N2O5 — CID 67092865
N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide (PubChem CID 67092865) has the molecular formula C36H48N2O5 and a molecular weight of 588.79 g/mol. Its IUPAC name is N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide.
| Compound Name | N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 67092865 |
| Molecular Formula | C36H48N2O5 |
| Molecular Weight | 588.79 g/mol |
| Exact Mass | 588.36 |
| IUPAC Name | N-[2-[2-(icosa-5,8,11,14,17-pentaenoylamino)ethoxy]ethyl]-5-methyl-4-oxo-5-phenylfuran-2-carboxamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCOCCNC(=O)C1=CC(=O)C(C)(c2ccccc2)O1 |
| InChI | InChI=1S/C36H48N2O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-25-34(40)37-26-28-42-29-27-38-35(41)32-30-33(39)36(2,43-32)31-23-20-19-21-24-31/h4-5,7-8,10-11,13-14,16-17,19-21,23-24,30H,3,6,9,12,15,18,22,25-29H2,1-2H3,(H,37,40)(H,38,41) |
| InChIKey | UHJHMTULBZNPLC-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.79 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|