C31H46N2O4 — CID 71509013
methyl (E)-4-[[1-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-methylpropan-2-yl]amino]-4-oxobut-2-enoate (PubChem CID 71509013) has the molecular formula C31H46N2O4 and a molecular weight of 510.72 g/mol. Its IUPAC name is methyl (E)-4-[[1-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-methylpropan-2-yl]amino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[[1-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-methylpropan-2-yl]amino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 71509013 |
| Molecular Formula | C31H46N2O4 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.35 |
| IUPAC Name | methyl (E)-4-[[1-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-methylpropan-2-yl]amino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCC(C)(C)NC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C31H46N2O4/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-28(34)32-27-31(2,3)33-29(35)25-26-30(36)37-4/h6-7,9-10,12-13,15-16,18-19,21-22,25-26H,5,8,11,14,17,20,23-24,27H2,1-4H3,(H,32,34)(H,33,35)/b7-6-,10-9-,13-12-,16-15-,19-18-,22-21-,26-25+ |
| InChIKey | RLLNVZJJBSPSLS-CETSVCOSSA-N |
| XLogP | 6.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|