C34H50N2O4 — CID 77264623
methyl 4-[[4-(docosa-4,7,10,13,16,19-hexaenoylamino)cyclohexyl]-methylamino]-4-oxobut-2-enoate (PubChem CID 77264623) has the molecular formula C34H50N2O4 and a molecular weight of 550.78 g/mol. Its IUPAC name is methyl 4-[[4-(docosa-4,7,10,13,16,19-hexaenoylamino)cyclohexyl]-methylamino]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[[4-(docosa-4,7,10,13,16,19-hexaenoylamino)cyclohexyl]-methylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 77264623 |
| Molecular Formula | C34H50N2O4 |
| Molecular Weight | 550.78 g/mol |
| Exact Mass | 550.38 |
| IUPAC Name | methyl 4-[[4-(docosa-4,7,10,13,16,19-hexaenoylamino)cyclohexyl]-methylamino]-4-oxobut-2-enoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)NC1CCC(N(C)C(=O)C=CC(=O)OC)CC1 |
| InChI | InChI=1S/C34H50N2O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-32(37)35-30-24-26-31(27-25-30)36(2)33(38)28-29-34(39)40-3/h5-6,8-9,11-12,14-15,17-18,20-21,28-31H,4,7,10,13,16,19,22-27H2,1-3H3,(H,35,37) |
| InChIKey | VCGMLYZTNGHPBN-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.78 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|