C32H44N2O4 — CID 118322329
methyl (E)-4-[(1R,4S)-5-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxobut-2-enoate (PubChem CID 118322329) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is methyl (E)-4-[(1R,4S)-5-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[(1R,4S)-5-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 118322329 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | methyl (E)-4-[(1R,4S)-5-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N1C[C@H]2C[C@H]1CN2C(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C32H44N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(35)33-26-29-25-28(33)27-34(29)31(36)23-24-32(37)38-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-24,28-29H,3,6,9,12,15,18,21-22,25-27H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23+/t28-,29+/m0/s1 |
| InChIKey | FPVFLPSKLVTWOB-VOARPNPISA-N |
| XLogP | 6.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|