C27H39NO4 — CID 66690874
1-docosa-4,7,10,13,16,19-hexaenoyl-4-hydroxypyrrolidine-2-carboxylic acid (PubChem CID 66690874) has the molecular formula C27H39NO4 and a molecular weight of 441.61 g/mol. Its IUPAC name is 1-docosa-4,7,10,13,16,19-hexaenoyl-4-hydroxypyrrolidine-2-carboxylic acid.
| Compound Name | 1-docosa-4,7,10,13,16,19-hexaenoyl-4-hydroxypyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66690874 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | 1-docosa-4,7,10,13,16,19-hexaenoyl-4-hydroxypyrrolidine-2-carboxylic acid |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)N1CC(O)CC1C(=O)O |
| InChI | InChI=1S/C27H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(30)28-23-24(29)22-25(28)27(31)32/h3-4,6-7,9-10,12-13,15-16,18-19,24-25,29H,2,5,8,11,14,17,20-23H2,1H3,(H,31,32) |
| InChIKey | ZACWGPMSIRFUMQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|