C32H46N2O4 — CID 67310649
methyl (E)-4-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-piperidin-4-ylamino]-4-oxobut-2-enoate (PubChem CID 67310649) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is methyl (E)-4-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-piperidin-4-ylamino]-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-piperidin-4-ylamino]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 67310649 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | methyl (E)-4-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-piperidin-4-ylamino]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N(C(=O)/C=C/C(=O)OC)C1CCNCC1 |
| InChI | InChI=1S/C32H46N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-30(35)34(29-25-27-33-28-26-29)31(36)23-24-32(37)38-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-24,29,33H,3,6,9,12,15,18,21-22,25-28H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23+ |
| InChIKey | ZGZKLBWDHHUAAA-CKDYJQHLSA-N |
| XLogP | 6.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|