C33H46N2O4 — CID 67311486
methyl 4-[1-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-oxobut-2-enoate (PubChem CID 67311486) has the molecular formula C33H46N2O4 and a molecular weight of 534.74 g/mol. Its IUPAC name is methyl 4-[1-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[1-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 67311486 |
| Molecular Formula | C33H46N2O4 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.35 |
| IUPAC Name | methyl 4-[1-[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)N1CCC2CN(C(=O)C=CC(=O)OC)CC21 |
| InChI | InChI=1S/C33H46N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-32(37)35-26-25-29-27-34(28-30(29)35)31(36)23-24-33(38)39-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-24,29-30H,3,6,9,12,15,18,21-22,25-28H2,1-2H3/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23? |
| InChIKey | MLDJYBBIAMKQDU-HSYIMPKRSA-N |
| XLogP | 6.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|