C32H44N2O4 — CID 67312131
methyl 4-[6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobut-2-enoate (PubChem CID 67312131) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is methyl 4-[6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobut-2-enoate.
| Compound Name | methyl 4-[6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 67312131 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | methyl 4-[6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-azabicyclo[3.1.0]hexan-3-yl]-4-oxobut-2-enoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NC1C2CN(C(=O)C=CC(=O)OC)CC21 |
| InChI | InChI=1S/C32H44N2O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-29(35)33-32-27-25-34(26-28(27)32)30(36)23-24-31(37)38-2/h4-5,7-8,10-11,13-14,16-17,19-20,23-24,27-28,32H,3,6,9,12,15,18,21-22,25-26H2,1-2H3,(H,33,35)/b5-4-,8-7-,11-10-,14-13-,17-16-,20-19-,24-23? |
| InChIKey | DNUWHERMPAUPCP-HSYIMPKRSA-N |
| XLogP | 5.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|