C30H40ClNO — CID 90008849
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-chlorophenyl)ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 90008849) has the molecular formula C30H40ClNO and a molecular weight of 466.11 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-chlorophenyl)ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-chlorophenyl)ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 90008849 |
| Molecular Formula | C30H40ClNO |
| Molecular Weight | 466.11 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-(2-chlorophenyl)ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCc1ccccc1Cl |
| InChI | InChI=1S/C30H40ClNO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-25-30(33)32-27-26-28-23-21-22-24-29(28)31/h3-4,6-7,9-10,12-13,15-16,18-19,21-24H,2,5,8,11,14,17,20,25-27H2,1H3,(H,32,33)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | MVVCVQLLUKEDCR-KUBAVDMBSA-N |
| XLogP | 8.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.11 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|