C38H54N2O7 — CID 59409971
1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[(2-hydroxybenzoyl)amino]hexanoate (PubChem CID 59409971) has the molecular formula C38H54N2O7 and a molecular weight of 650.86 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[(2-hydroxybenzoyl)amino]hexanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[(2-hydroxybenzoyl)amino]hexanoate |
|---|---|
| PubChem CID | 59409971 |
| Molecular Formula | C38H54N2O7 |
| Molecular Weight | 650.86 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 6-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-2-[(2-hydroxybenzoyl)amino]hexanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCCCC(NC(=O)c1ccccc1O)C(=O)OC(CO)CO |
| InChI | InChI=1S/C38H54N2O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-28-36(44)39-29-24-23-26-34(38(46)47-32(30-41)31-42)40-37(45)33-25-21-22-27-35(33)43/h3-4,6-7,9-10,12-13,15-16,18-19,21-22,25,27,32,34,41-43H,2,5,8,11,14,17,20,23-24,26,28-31H2,1H3,(H,39,44)(H,40,45)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18- |
| InChIKey | SQYQAIPCWUABSM-KUBAVDMBSA-N |
| XLogP | 6.15 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|