C34H52N2O8 — CID 87351224
1,3-dihydroxypropan-2-yl 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-6-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate (PubChem CID 87351224) has the molecular formula C34H52N2O8 and a molecular weight of 616.80 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-6-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-6-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 87351224 |
| Molecular Formula | C34H52N2O8 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 2-[[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoyl]amino]-6-[[(E)-4-methoxy-4-oxobut-2-enoyl]amino]hexanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC(CCCCNC(=O)/C=C/C(=O)OC)C(=O)OC(CO)CO |
| InChI | InChI=1S/C34H52N2O8/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23-32(40)36-30(34(42)44-29(27-37)28-38)22-20-21-26-35-31(39)24-25-33(41)43-2/h4-5,7-8,10-11,13-14,16-17,24-25,29-30,37-38H,3,6,9,12,15,18-23,26-28H2,1-2H3,(H,35,39)(H,36,40)/b5-4-,8-7-,11-10-,14-13-,17-16-,25-24+ |
| InChIKey | HAYYPMVFKOCMJQ-PSOVHKSISA-N |
| XLogP | 4.30 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|