C34H52N2O8 — CID 173062453
1,3-dihydroxypropan-2-yl (2S)-2-[(4-ethoxy-4-oxobut-2-enoyl)amino]-5-(icosa-5,8,11,14,17-pentaenoylamino)pentanoate (PubChem CID 173062453) has the molecular formula C34H52N2O8 and a molecular weight of 616.80 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (2S)-2-[(4-ethoxy-4-oxobut-2-enoyl)amino]-5-(icosa-5,8,11,14,17-pentaenoylamino)pentanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (2S)-2-[(4-ethoxy-4-oxobut-2-enoyl)amino]-5-(icosa-5,8,11,14,17-pentaenoylamino)pentanoate |
|---|---|
| PubChem CID | 173062453 |
| Molecular Formula | C34H52N2O8 |
| Molecular Weight | 616.80 g/mol |
| Exact Mass | 616.37 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (2S)-2-[(4-ethoxy-4-oxobut-2-enoyl)amino]-5-(icosa-5,8,11,14,17-pentaenoylamino)pentanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCC[C@H](NC(=O)C=CC(=O)OCC)C(=O)OC(CO)CO |
| InChI | InChI=1S/C34H52N2O8/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23-31(39)35-26-21-22-30(34(42)44-29(27-37)28-38)36-32(40)24-25-33(41)43-4-2/h5-6,8-9,11-12,14-15,17-18,24-25,29-30,37-38H,3-4,7,10,13,16,19-23,26-28H2,1-2H3,(H,35,39)(H,36,40)/t30-/m0/s1 |
| InChIKey | MDVFWXVLLAXIID-PMERELPUSA-N |
| XLogP | 4.30 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.80 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|