C27H45NO3 — CID 178188600
(5E,8E,11E,14E,17E)-N-[6-hydroxy-5-(hydroxymethyl)hexyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 178188600) has the molecular formula C27H45NO3 and a molecular weight of 431.66 g/mol. Its IUPAC name is (5E,8E,11E,14E,17E)-N-[6-hydroxy-5-(hydroxymethyl)hexyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | (5E,8E,11E,14E,17E)-N-[6-hydroxy-5-(hydroxymethyl)hexyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 178188600 |
| Molecular Formula | C27H45NO3 |
| Molecular Weight | 431.66 g/mol |
| Exact Mass | 431.34 |
| IUPAC Name | (5E,8E,11E,14E,17E)-N-[6-hydroxy-5-(hydroxymethyl)hexyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCCC(=O)NCCCCC(CO)CO |
| InChI | InChI=1S/C27H45NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-27(31)28-23-20-19-21-26(24-29)25-30/h3-4,6-7,9-10,12-13,15-16,26,29-30H,2,5,8,11,14,17-25H2,1H3,(H,28,31)/b4-3+,7-6+,10-9+,13-12+,16-15+ |
| InChIKey | ZRWUADSGTPLOPV-RCHUDCCISA-N |
| XLogP | 5.80 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|