C39H74N2O2 — CID 156747342
hexadecanamide;(9Z,12Z,15Z)-N-pentyloctadeca-9,12,15-trienamide (PubChem CID 156747342) has the molecular formula C39H74N2O2 and a molecular weight of 603.03 g/mol. Its IUPAC name is hexadecanamide;(9Z,12Z,15Z)-N-pentyloctadeca-9,12,15-trienamide.
| Compound Name | hexadecanamide;(9Z,12Z,15Z)-N-pentyloctadeca-9,12,15-trienamide |
|---|---|
| PubChem CID | 156747342 |
| Molecular Formula | C39H74N2O2 |
| Molecular Weight | 603.03 g/mol |
| Exact Mass | 602.58 |
| IUPAC Name | hexadecanamide;(9Z,12Z,15Z)-N-pentyloctadeca-9,12,15-trienamide |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NCCCCC.CCCCCCCCCCCCCCCC(N)=O |
| InChI | InChI=1S/C23H41NO.C16H33NO/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-21-23(25)24-22-20-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h5,7,9-10,12-13H,3-4,6,8,11,14-22H2,1-2H3,(H,24,25);2-15H2,1H3,(H2,17,18)/b7-5-,10-9-,13-12-; |
| InChIKey | HTEZFRXERMRETD-TTYJXLOASA-N |
| XLogP | 11.84 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.03 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|