C36H54N2O8 — CID 173062414
1,3-dihydroxypropan-2-yl (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-[(4-ethoxy-4-oxobut-2-enoyl)amino]pentanoate (PubChem CID 173062414) has the molecular formula C36H54N2O8 and a molecular weight of 642.83 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-[(4-ethoxy-4-oxobut-2-enoyl)amino]pentanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-[(4-ethoxy-4-oxobut-2-enoyl)amino]pentanoate |
|---|---|
| PubChem CID | 173062414 |
| Molecular Formula | C36H54N2O8 |
| Molecular Weight | 642.83 g/mol |
| Exact Mass | 642.39 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl (2S)-2-(docosa-4,7,10,13,16,19-hexaenoylamino)-5-[(4-ethoxy-4-oxobut-2-enoyl)amino]pentanoate |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)N[C@@H](CCCNC(=O)C=CC(=O)OCC)C(=O)OC(CO)CO |
| InChI | InChI=1S/C36H54N2O8/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-25-34(42)38-32(36(44)46-31(29-39)30-40)24-23-28-37-33(41)26-27-35(43)45-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,26-27,31-32,39-40H,3-4,7,10,13,16,19,22-25,28-30H2,1-2H3,(H,37,41)(H,38,42)/t32-/m0/s1 |
| InChIKey | HKCAQIRXVKEAKX-YTTGMZPUSA-N |
| XLogP | 4.86 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.83 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|