C26H40N2O6 — CID 89433539
1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanoate (PubChem CID 89433539) has the molecular formula C26H40N2O6 and a molecular weight of 476.61 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanoate |
|---|---|
| PubChem CID | 89433539 |
| Molecular Formula | C26H40N2O6 |
| Molecular Weight | 476.61 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]butanoate |
| SMILES | CC/C=C\CC(=O)NCCC(NC(=O)C(C)c1ccc(CC(C)C)cc1)C(=O)OC(CO)CO |
| InChI | InChI=1S/C26H40N2O6/c1-5-6-7-8-24(31)27-14-13-23(26(33)34-22(16-29)17-30)28-25(32)19(4)21-11-9-20(10-12-21)15-18(2)3/h6-7,9-12,18-19,22-23,29-30H,5,8,13-17H2,1-4H3,(H,27,31)(H,28,32)/b7-6- |
| InChIKey | KRWFDLNQEVTOED-SREVYHEPSA-N |
| XLogP | 2.23 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.61 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|