C40H61N3O2 — CID 53378535
(4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[methyl-[2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]ethyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide (PubChem CID 53378535) has the molecular formula C40H61N3O2 and a molecular weight of 615.95 g/mol. Its IUPAC name is (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[methyl-[2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]ethyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide.
| Compound Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[methyl-[2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]ethyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
|---|---|
| PubChem CID | 53378535 |
| Molecular Formula | C40H61N3O2 |
| Molecular Weight | 615.95 g/mol |
| Exact Mass | 615.48 |
| IUPAC Name | (4Z,7Z,10Z,13Z,16Z,19Z)-N-[2-[methyl-[2-[2-[4-(2-methylpropyl)phenyl]propanoylamino]ethyl]amino]ethyl]docosa-4,7,10,13,16,19-hexaenamide |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NCCN(C)CCNC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C40H61N3O2/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-39(44)41-30-32-43(5)33-31-42-40(45)36(4)38-28-26-37(27-29-38)34-35(2)3/h7-8,10-11,13-14,16-17,19-20,22-23,26-29,35-36H,6,9,12,15,18,21,24-25,30-34H2,1-5H3,(H,41,44)(H,42,45)/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | ODWLTWWDOMEPIK-XTJKPUCJSA-N |
| XLogP | 8.63 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.95 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|