C19H27N3O6 — CID 58173177
1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-(pyridine-3-carbonylamino)butanoate (PubChem CID 58173177) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-(pyridine-3-carbonylamino)butanoate.
| Compound Name | 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-(pyridine-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 58173177 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 1,3-dihydroxypropan-2-yl 4-[[(Z)-hex-3-enoyl]amino]-2-(pyridine-3-carbonylamino)butanoate |
| SMILES | CC/C=C\CC(=O)NCCC(NC(=O)c1cccnc1)C(=O)OC(CO)CO |
| InChI | InChI=1S/C19H27N3O6/c1-2-3-4-7-17(25)21-10-8-16(19(27)28-15(12-23)13-24)22-18(26)14-6-5-9-20-11-14/h3-6,9,11,15-16,23-24H,2,7-8,10,12-13H2,1H3,(H,21,25)(H,22,26)/b4-3- |
| InChIKey | WSGILNXXIYFNEN-ARJAWSKDSA-N |
| XLogP | -0.06 |
| TPSA | 137.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|