C12H16N2O5S — CID 141299622
methyl 4-methylsulfonyl-2-(pyridine-3-carbonylamino)butanoate (PubChem CID 141299622) has the molecular formula C12H16N2O5S and a molecular weight of 300.34 g/mol. Its IUPAC name is methyl 4-methylsulfonyl-2-(pyridine-3-carbonylamino)butanoate.
| Compound Name | methyl 4-methylsulfonyl-2-(pyridine-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 141299622 |
| Molecular Formula | C12H16N2O5S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | methyl 4-methylsulfonyl-2-(pyridine-3-carbonylamino)butanoate |
| SMILES | COC(=O)C(CCS(C)(=O)=O)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C12H16N2O5S/c1-19-12(16)10(5-7-20(2,17)18)14-11(15)9-4-3-6-13-8-9/h3-4,6,8,10H,5,7H2,1-2H3,(H,14,15) |
| InChIKey | MNPJPMMHCHSWDS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |