C23H21N3O5 — CID 102573921
methyl (2S)-3-[4-[(4-hydroxybenzoyl)amino]phenyl]-2-(pyridine-3-carbonylamino)propanoate (PubChem CID 102573921) has the molecular formula C23H21N3O5 and a molecular weight of 419.44 g/mol. Its IUPAC name is methyl (2S)-3-[4-[(4-hydroxybenzoyl)amino]phenyl]-2-(pyridine-3-carbonylamino)propanoate.
| Compound Name | methyl (2S)-3-[4-[(4-hydroxybenzoyl)amino]phenyl]-2-(pyridine-3-carbonylamino)propanoate |
|---|---|
| PubChem CID | 102573921 |
| Molecular Formula | C23H21N3O5 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | methyl (2S)-3-[4-[(4-hydroxybenzoyl)amino]phenyl]-2-(pyridine-3-carbonylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(NC(=O)c2ccc(O)cc2)cc1)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C23H21N3O5/c1-31-23(30)20(26-22(29)17-3-2-12-24-14-17)13-15-4-8-18(9-5-15)25-21(28)16-6-10-19(27)11-7-16/h2-12,14,20,27H,13H2,1H3,(H,25,28)(H,26,29)/t20-/m0/s1 |
| InChIKey | QVNOMKSERAXGMF-FQEVSTJZSA-N |
| XLogP | 2.55 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |