C24H23N3O5 — CID 16751778
methyl (3R)-4-[4-[(4-hydroxybenzoyl)amino]phenyl]-3-(pyridine-3-carbonylamino)butanoate (PubChem CID 16751778) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is methyl (3R)-4-[4-[(4-hydroxybenzoyl)amino]phenyl]-3-(pyridine-3-carbonylamino)butanoate.
| Compound Name | methyl (3R)-4-[4-[(4-hydroxybenzoyl)amino]phenyl]-3-(pyridine-3-carbonylamino)butanoate |
|---|---|
| PubChem CID | 16751778 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | methyl (3R)-4-[4-[(4-hydroxybenzoyl)amino]phenyl]-3-(pyridine-3-carbonylamino)butanoate |
| SMILES | COC(=O)C[C@@H](Cc1ccc(NC(=O)c2ccc(O)cc2)cc1)NC(=O)c1cccnc1 |
| InChI | InChI=1S/C24H23N3O5/c1-32-22(29)14-20(27-24(31)18-3-2-12-25-15-18)13-16-4-8-19(9-5-16)26-23(30)17-6-10-21(28)11-7-17/h2-12,15,20,28H,13-14H2,1H3,(H,26,30)(H,27,31)/t20-/m1/s1 |
| InChIKey | CHRJJHZGTHUJBL-HXUWFJFHSA-N |
| XLogP | 2.94 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |