C17H20N2O5S — CID 59948443
methyl (2S)-2-[(4-aminonaphthalene-1-carbonyl)amino]-4-methylsulfonylbutanoate (PubChem CID 59948443) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is methyl (2S)-2-[(4-aminonaphthalene-1-carbonyl)amino]-4-methylsulfonylbutanoate.
| Compound Name | methyl (2S)-2-[(4-aminonaphthalene-1-carbonyl)amino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 59948443 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | methyl (2S)-2-[(4-aminonaphthalene-1-carbonyl)amino]-4-methylsulfonylbutanoate |
| SMILES | COC(=O)[C@H](CCS(C)(=O)=O)NC(=O)c1ccc(N)c2ccccc12 |
| InChI | InChI=1S/C17H20N2O5S/c1-24-17(21)15(9-10-25(2,22)23)19-16(20)13-7-8-14(18)12-6-4-3-5-11(12)13/h3-8,15H,9-10,18H2,1-2H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | FZRIKDOISDITLJ-HNNXBMFYSA-N |
| XLogP | 1.13 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|