C13H16ClNO7S2 — CID 54122544
methyl 2-[(3-chlorosulfonylbenzoyl)amino]-4-methylsulfonylbutanoate (PubChem CID 54122544) has the molecular formula C13H16ClNO7S2 and a molecular weight of 397.86 g/mol. Its IUPAC name is methyl 2-[(3-chlorosulfonylbenzoyl)amino]-4-methylsulfonylbutanoate.
| Compound Name | methyl 2-[(3-chlorosulfonylbenzoyl)amino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 54122544 |
| Molecular Formula | C13H16ClNO7S2 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.01 |
| IUPAC Name | methyl 2-[(3-chlorosulfonylbenzoyl)amino]-4-methylsulfonylbutanoate |
| SMILES | COC(=O)C(CCS(C)(=O)=O)NC(=O)c1cccc(S(=O)(=O)Cl)c1 |
| InChI | InChI=1S/C13H16ClNO7S2/c1-22-13(17)11(6-7-23(2,18)19)15-12(16)9-4-3-5-10(8-9)24(14,20)21/h3-5,8,11H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | NOTJBIOWSZBKDC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 123.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |