C14H18BrNO5S — CID 42942364
ethyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate (PubChem CID 42942364) has the molecular formula C14H18BrNO5S and a molecular weight of 392.27 g/mol. Its IUPAC name is ethyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate.
| Compound Name | ethyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 42942364 |
| Molecular Formula | C14H18BrNO5S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | ethyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate |
| SMILES | CCOC(=O)C(CCS(C)(=O)=O)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C14H18BrNO5S/c1-3-21-14(18)12(8-9-22(2,19)20)16-13(17)10-6-4-5-7-11(10)15/h4-7,12H,3,8-9H2,1-2H3,(H,16,17) |
| InChIKey | KOIZVVSCKREUIU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |