C19H20BrNO5S — CID 45355349
benzyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate (PubChem CID 45355349) has the molecular formula C19H20BrNO5S and a molecular weight of 454.34 g/mol. Its IUPAC name is benzyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate.
| Compound Name | benzyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 45355349 |
| Molecular Formula | C19H20BrNO5S |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | benzyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate |
| SMILES | CS(=O)(=O)CCC(NC(=O)c1ccccc1Br)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20BrNO5S/c1-27(24,25)12-11-17(19(23)26-13-14-7-3-2-4-8-14)21-18(22)15-9-5-6-10-16(15)20/h2-10,17H,11-13H2,1H3,(H,21,22) |
| InChIKey | JESYWZDDVMETIF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |