C12H20N2O3S2 — CID 158216878
2-amino-N-[(2S)-4-methylsulfonylbutan-2-yl]benzamide;sulfane (PubChem CID 158216878) has the molecular formula C12H20N2O3S2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 2-amino-N-[(2S)-4-methylsulfonylbutan-2-yl]benzamide;sulfane.
| Compound Name | 2-amino-N-[(2S)-4-methylsulfonylbutan-2-yl]benzamide;sulfane |
|---|---|
| PubChem CID | 158216878 |
| Molecular Formula | C12H20N2O3S2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-amino-N-[(2S)-4-methylsulfonylbutan-2-yl]benzamide;sulfane |
| SMILES | C[C@@H](CCS(C)(=O)=O)NC(=O)c1ccccc1N.S |
| InChI | InChI=1S/C12H18N2O3S.H2S/c1-9(7-8-18(2,16)17)14-12(15)10-5-3-4-6-11(10)13;/h3-6,9H,7-8,13H2,1-2H3,(H,14,15);1H2/t9-;/m0./s1 |
| InChIKey | GCTMHUVLHTUSFX-FVGYRXGTSA-N |
| XLogP | 0.93 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|