C11H14N2O6S — CID 87371196
(2S)-2-[(2-aminobenzoyl)amino]-4-sulfobutanoic acid (PubChem CID 87371196) has the molecular formula C11H14N2O6S and a molecular weight of 302.31 g/mol. Its IUPAC name is (2S)-2-[(2-aminobenzoyl)amino]-4-sulfobutanoic acid.
| Compound Name | (2S)-2-[(2-aminobenzoyl)amino]-4-sulfobutanoic acid |
|---|---|
| PubChem CID | 87371196 |
| Molecular Formula | C11H14N2O6S |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (2S)-2-[(2-aminobenzoyl)amino]-4-sulfobutanoic acid |
| SMILES | Nc1ccccc1C(=O)N[C@@H](CCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H14N2O6S/c12-8-4-2-1-3-7(8)10(14)13-9(11(15)16)5-6-20(17,18)19/h1-4,9H,5-6,12H2,(H,13,14)(H,15,16)(H,17,18,19)/t9-/m0/s1 |
| InChIKey | LNYJUWIUMNWUDM-VIFPVBQESA-N |
| XLogP | -0.27 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|